| Name |
methyl (2E)-5-(3,4-dimethoxyphenyl)-2-(4-fluorobenzylidene)-7-methyl-3-oxo-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
|
| Molecular Formula |
C24H21FN2O5S
|
| Molecular Weight |
468.5
|
| Smiles |
COC(=O)C1=C(C)N=c2sc(=Cc3ccc(F)cc3)c(=O)n2C1c1ccc(OC)c(OC)c1
|
COC(=O)C1=C(C)N=c2sc(=Cc3ccc(F)cc3)c(=O)n2C1c1ccc(OC)c(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.