| Name |
4-(4-Chloro-2-methylphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
|
| Molecular Formula |
C9H8ClN3S
|
| Molecular Weight |
225.70
|
| Smiles |
Cc1cc(Cl)ccc1-n1cn[nH]c1=S
|
Cc1cc(Cl)ccc1-n1cn[nH]c1=S
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.