| Name |
(4R,7aS,12bS)-6-chloro-9-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline
|
| Molecular Formula |
C18H18ClNO2
|
| Molecular Weight |
315.8
|
| Smiles |
COc1ccc2c3c1OC1C=C(Cl)C=C4C(C2)N(C)CCC431
|
COc1ccc2c3c1OC1C=C(Cl)C=C4C(C2)N(C)CCC431
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.