| Name |
6,7-Dimethoxy-3,4-dihydro-1,2,4-benzothiadiazine-3-one 1,1-dioxide
|
| Molecular Formula |
C9H10N2O5S
|
| Molecular Weight |
258.25
|
| Smiles |
COc1cc2c(cc1OC)S(=O)(=O)NC(=O)N2
|
COc1cc2c(cc1OC)S(=O)(=O)NC(=O)N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.