| Name |
1-(2-chlorobenzyl)-5-(4-methylphenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2,3]triazole-4,6(1H,5H)-dione
|
| Molecular Formula |
C18H15ClN4O2
|
| Molecular Weight |
354.8
|
| Smiles |
Cc1ccc(N2C(=O)C3N=NN(Cc4ccccc4Cl)C3C2=O)cc1
|
Cc1ccc(N2C(=O)C3N=NN(Cc4ccccc4Cl)C3C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.