| Name |
8-Quinolinesulfonamide,7-chloro-n-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-
|
| Molecular Formula |
C16H14ClN5O5S
|
| Molecular Weight |
423.8
|
| Smiles |
COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2c(Cl)ccc3cccnc23)n1
|
COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2c(Cl)ccc3cccnc23)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.