| Name |
7-benzyl-3-phenyl-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one
|
| Molecular Formula |
C17H12N4OS
|
| Molecular Weight |
320.4
|
| Smiles |
O=c1c(-c2ccccc2)nnc2sc(Cc3ccccc3)nn12
|
O=c1c(-c2ccccc2)nnc2sc(Cc3ccccc3)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.