| Name |
(1S,2R,3S,4R)-2,3-Dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid
|
| Molecular Formula |
C11H19NO6
|
| Molecular Weight |
261.27
|
| Smiles |
CC(C)(C)OC(=O)NC1CC(C(=O)O)C(O)C1O
|
CC(C)(C)OC(=O)NC1CC(C(=O)O)C(O)C1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.