| Name |
(3S,11E)-14-(Acetyloxy)-3,4,5,6,9,10-hexahydro-16-hydroxy-3-methyl-1H-2-benzoxacyclotetradecin-1,7(8H)-dione
|
| Molecular Formula |
C20H24O6
|
| Molecular Weight |
360.4
|
| Smiles |
CC(=O)Oc1cc(O)c2c(c1)C=CCCCC(=O)CCCC(C)OC2=O
|
CC(=O)Oc1cc(O)c2c(c1)C=CCCCC(=O)CCCC(C)OC2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.