| Name |
2-(4-Chlorophenyl)-6,7-dihydro-1H-[1,4]dioxino[2',3':4,5]benzo[1,2-d]imidazole
|
| Molecular Formula |
C15H11ClN2O2
|
| Molecular Weight |
286.71
|
| Smiles |
Clc1ccc(-c2nc3cc4c(cc3[nH]2)OCCO4)cc1
|
Clc1ccc(-c2nc3cc4c(cc3[nH]2)OCCO4)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.