| Name |
2-[3,4-Bis(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetic acid
|
| Molecular Formula |
C17H13Cl2NO3
|
| Molecular Weight |
350.2
|
| Smiles |
O=C(O)CC1ON=C(c2ccc(Cl)cc2)C1c1ccc(Cl)cc1
|
O=C(O)CC1ON=C(c2ccc(Cl)cc2)C1c1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.