| Name |
(8R,8'R,9S)-9-Hydroxy-3,4-dimethoxy-3',4'-methylenoxy-9,9'-epoxylignan
|
| Molecular Formula |
C21H24O6
|
| Molecular Weight |
372.4
|
| Smiles |
COc1ccc(CC2C(Cc3ccc4c(c3)OCO4)COC2O)cc1OC
|
COc1ccc(CC2C(Cc3ccc4c(c3)OCO4)COC2O)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.