| Name |
(S)-5-Benzyl-2-phenyl-5,6-dihydro-8H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-ium chloride
|
| Molecular Formula |
C18H18ClN3O
|
| Molecular Weight |
327.8
|
| Smiles |
[Cl-].c1ccc(CC2COCc3nn(-c4ccccc4)c[n+]32)cc1
|
[Cl-].c1ccc(CC2COCc3nn(-c4ccccc4)c[n+]32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.