| Name |
Methyl ({7-oxo-5-[(pyrimidin-2-ylthio)methyl]-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-2-yl}thio)acetate
|
| Molecular Formula |
C13H12N6O3S2
|
| Molecular Weight |
364.4
|
| Smiles |
COC(=O)CSc1nc2nc(CSc3ncccn3)cc(=O)n2[nH]1
|
COC(=O)CSc1nc2nc(CSc3ncccn3)cc(=O)n2[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.