| Name |
1-{[3-(Thiophen-3-yl)-1,2,4-oxadiazol-5-yl]methyl}piperazine hydrochloride
|
| Molecular Formula |
C11H15ClN4OS
|
| Molecular Weight |
286.78
|
| Smiles |
Cl.c1cc(-c2noc(CN3CCNCC3)n2)cs1
|
Cl.c1cc(-c2noc(CN3CCNCC3)n2)cs1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.