| Name |
(S)-Methyl 5-((S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-5-((tert-butoxycarbonyl)amino)pentanamido)-2-(2-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetamido)pentanoate
|
| Molecular Formula |
C38H48N6O10
|
| Molecular Weight |
748.8
|
| Smiles |
COC(=O)C(CCCNC(=O)C(CCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)Cn1cc(C)c(=O)[nH]c1=O
|
COC(=O)C(CCCNC(=O)C(CCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)Cn1cc(C)c(=O)[nH]c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.