| Name |
7-(furan-2-yl)-5-((2-(indolin-1-yl)-2-oxoethyl)thio)-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4(1H,3H)-dione
|
| Molecular Formula |
C22H19N5O4S
|
| Molecular Weight |
449.5
|
| Smiles |
Cn1c(=O)c2c(SCC(=O)N3CCc4ccccc43)nc(-c3ccco3)nc2n(C)c1=O
|
Cn1c(=O)c2c(SCC(=O)N3CCc4ccccc43)nc(-c3ccco3)nc2n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.