| Name |
2-[5-(3,4-dimethoxyphenyl)-4,6-dioxo-1H,3aH,4H,5H,6H,6aH-pyrrolo[3,4-d][1,2,3]triazol-1-yl]-N-(3-methylphenyl)acetamide
|
| Molecular Formula |
C21H21N5O5
|
| Molecular Weight |
423.4
|
| Smiles |
COc1ccc(N2C(=O)C3N=NN(CC(=O)Nc4cccc(C)c4)C3C2=O)cc1OC
|
COc1ccc(N2C(=O)C3N=NN(CC(=O)Nc4cccc(C)c4)C3C2=O)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.