| Name |
4-(3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl)-1-(2-(trifluoromethyl)phenyl)-1H-1,2,3-triazol-5-amine
|
| Molecular Formula |
C17H10F4N6O
|
| Molecular Weight |
390.29
|
| Smiles |
Nc1c(-c2nc(-c3ccc(F)cc3)no2)nnn1-c1ccccc1C(F)(F)F
|
Nc1c(-c2nc(-c3ccc(F)cc3)no2)nnn1-c1ccccc1C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.