| Name |
4-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,3-dimethylphenyl)-1H-1,2,3-triazol-5-amine
|
| Molecular Formula |
C18H15BrN6O
|
| Molecular Weight |
411.3
|
| Smiles |
Cc1cccc(-n2nnc(-c3nc(-c4ccc(Br)cc4)no3)c2N)c1C
|
Cc1cccc(-n2nnc(-c3nc(-c4ccc(Br)cc4)no3)c2N)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.