| Name |
N-(4-chlorobenzyl)-N-(1,1-dioxidotetrahydrothiophen-3-yl)-2-[5-(propan-2-yl)-1-benzofuran-3-yl]acetamide
|
| Molecular Formula |
C24H26ClNO4S
|
| Molecular Weight |
460.0
|
| Smiles |
CC(C)c1ccc2occ(CC(=O)N(Cc3ccc(Cl)cc3)C3CCS(=O)(=O)C3)c2c1
|
CC(C)c1ccc2occ(CC(=O)N(Cc3ccc(Cl)cc3)C3CCS(=O)(=O)C3)c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.