| Name |
N-(4-amino-6-{[4-(4-fluorophenyl)piperazino]methyl}-1,3,5-triazin-2-yl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)amine
|
| Molecular Formula |
C22H24FN7O2
|
| Molecular Weight |
437.5
|
| Smiles |
Nc1nc(CN2CCN(c3ccc(F)cc3)CC2)nc(Nc2ccc3c(c2)OCCO3)n1
|
Nc1nc(CN2CCN(c3ccc(F)cc3)CC2)nc(Nc2ccc3c(c2)OCCO3)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.