| Name |
(14aS,26aR)-2,3,13,14,14a,15,26,26a-Octahydro-22,30-dimethoxy-14-methyl-1H-4,6:16,19-dietheno-21,25-metheno-12H-[1,3]dioxolo[4,5-g]pyrido[2 inverted exclamation marka,3 inverted exclamation marka:17,18][1,10]dioxacycloeicosino[2,3,4-ij]isoquinoline
|
| Molecular Formula |
C36H36N2O6
|
| Molecular Weight |
592.7
|
| Smiles |
COc1ccc2cc1Oc1ccc(cc1)CC1NCCc3cc4c(c(c31)Oc1cc3c(cc1OC)CCN(C)C3C2)OCO4
|
COc1ccc2cc1Oc1ccc(cc1)CC1NCCc3cc4c(c(c31)Oc1cc3c(cc1OC)CCN(C)C3C2)OCO4
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.