| Name |
2'-Amino-6'-ethyl-7'-methyl-2,5'-dioxo-1,2,5',6'-tetrahydrospiro[indole-3,4'-pyrano[3,2-c]pyridine]-3'-carbonitrile
|
| Molecular Formula |
C19H16N4O3
|
| Molecular Weight |
348.4
|
| Smiles |
CCn1c(C)cc2c(c1=O)C1(C(=O)Nc3ccccc31)C(C#N)=C(N)O2
|
CCn1c(C)cc2c(c1=O)C1(C(=O)Nc3ccccc31)C(C#N)=C(N)O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.