| Name |
2-({3-[2-(4-Methoxybenzenesulfonamido)ethyl]-[1,2,4]triazolo[4,3-B]pyridazin-6-YL}sulfanyl)-N-(2-methylphenyl)acetamide
|
| Molecular Formula |
C23H24N6O4S2
|
| Molecular Weight |
512.6
|
| Smiles |
COc1ccc(S(=O)(=O)NCCc2nnc3ccc(SCC(=O)Nc4ccccc4C)nn23)cc1
|
COc1ccc(S(=O)(=O)NCCc2nnc3ccc(SCC(=O)Nc4ccccc4C)nn23)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.