| Name |
[(2R,3S,5S,8S,9S,10R,13R,14S,17R)-2-acetyloxy-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate
|
| Molecular Formula |
C33H52O5
|
| Molecular Weight |
528.8
|
| Smiles |
CCC(C=CC(C)C1CCC2C3CC(=O)C4CC(OC(C)=O)C(OC(C)=O)CC4(C)C3CCC12C)C(C)C
|
CCC(C=CC(C)C1CCC2C3CC(=O)C4CC(OC(C)=O)C(OC(C)=O)CC4(C)C3CCC12C)C(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.