| Name |
N-(5-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-1,3,4-oxadiazol-2-yl)-3-((4-methoxyphenyl)sulfonyl)propanamide
|
| Molecular Formula |
C20H19N3O7S
|
| Molecular Weight |
445.4
|
| Smiles |
COc1ccc(S(=O)(=O)CCC(=O)Nc2nnc(-c3ccc4c(c3)OCCO4)o2)cc1
|
COc1ccc(S(=O)(=O)CCC(=O)Nc2nnc(-c3ccc4c(c3)OCCO4)o2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.