| Name |
(2R,3R,4S,5R)-2-[6-amino-8-[3-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]propylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol
|
| Molecular Formula |
C23H32N12O8
|
| Molecular Weight |
604.6
|
| Smiles |
Nc1ncnc2c1nc(NCCCNc1nc3c(N)ncnc3n1C1OC(CO)C(O)C1O)n2C1OC(CO)C(O)C1O
|
Nc1ncnc2c1nc(NCCCNc1nc3c(N)ncnc3n1C1OC(CO)C(O)C1O)n2C1OC(CO)C(O)C1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.