| Name |
4-[(6R,9S,13S)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid
|
| Molecular Formula |
C15H26N2O2
|
| Molecular Weight |
266.38
|
| Smiles |
O=C(O)CCCC1NCC2CCCN3CCCC1C23
|
O=C(O)CCCC1NCC2CCCN3CCCC1C23
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.