| Name |
(4S,4'S)-2,2'-(2-Bromo-1,3-phenylene)bis(4-Benzyl-4,5-dihydrooxazole)
|
| Molecular Formula |
C26H23BrN2O2
|
| Molecular Weight |
475.4
|
| Smiles |
Brc1c(C2=NC(Cc3ccccc3)CO2)cccc1C1=NC(Cc2ccccc2)CO1
|
Brc1c(C2=NC(Cc3ccccc3)CO2)cccc1C1=NC(Cc2ccccc2)CO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.