| Name |
2-[[5-(4-Chlorophenyl)-1,4-dihydro-4-oxothieno[2,3-d]pyrimidin-2-yl]methyl]-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide
|
| Molecular Formula |
C23H19ClN4O2S
|
| Molecular Weight |
450.9
|
| Smiles |
NC(=O)C1Cc2ccccc2CN1Cc1nc2scc(-c3ccc(Cl)cc3)c2c(=O)[nH]1
|
NC(=O)C1Cc2ccccc2CN1Cc1nc2scc(-c3ccc(Cl)cc3)c2c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.