| Name |
(Z)-3-(benzo[d][1,3]dioxol-5-yl)-N-(2-(3,5-dimethylphenyl)-4,6-dihydro-2H-thieno[3,4-c]pyrazol-3-yl)acrylamide
|
| Molecular Formula |
C23H21N3O3S
|
| Molecular Weight |
419.5
|
| Smiles |
Cc1cc(C)cc(-n2nc3c(c2NC(=O)C=Cc2ccc4c(c2)OCO4)CSC3)c1
|
Cc1cc(C)cc(-n2nc3c(c2NC(=O)C=Cc2ccc4c(c2)OCO4)CSC3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.