| Name |
N-[(4-fluorophenyl)methyl]-2-({6-oxo-5-[(thiophen-2-yl)methyl]-8-oxa-3,5-diazatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),3,10,12-pentaen-4-yl}sulfanyl)acetamide
|
| Molecular Formula |
C24H18FN3O3S2
|
| Molecular Weight |
479.6
|
| Smiles |
O=C(CSc1nc2c(oc3ccccc32)c(=O)n1Cc1cccs1)NCc1ccc(F)cc1
|
O=C(CSc1nc2c(oc3ccccc32)c(=O)n1Cc1cccs1)NCc1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.