| Name |
3,4,5-trimethoxy-N-{[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl}benzamide
|
| Molecular Formula |
C21H22N2O5
|
| Molecular Weight |
382.4
|
| Smiles |
COc1cc(C(=O)NCc2cc(-c3ccc(C)cc3)on2)cc(OC)c1OC
|
COc1cc(C(=O)NCc2cc(-c3ccc(C)cc3)on2)cc(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.