| Name |
(3aR,4R,8R,8aR)-6-[[4-[3-[4-[[(3aR,4R,8R,8aR)-4,8-dihydroxy-2,2-dimethyl-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-d]azepin-6-yl]methyl]phenoxy]propoxy]phenyl]methyl]-2,2-dimethyl-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-d]azepine-4,8-diol
|
| Molecular Formula |
C35H50N2O10
|
| Molecular Weight |
658.8
|
| Smiles |
CC1(C)OC2C(O)CN(Cc3ccc(OCCCOc4ccc(CN5CC(O)C6OC(C)(C)OC6C(O)C5)cc4)cc3)CC(O)C2O1
|
CC1(C)OC2C(O)CN(Cc3ccc(OCCCOc4ccc(CN5CC(O)C6OC(C)(C)OC6C(O)C5)cc4)cc3)CC(O)C2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.