| Name |
1-(4-ethoxyphenyl)-3-hydroxy-3-(p-tolyl)-3,5,6,7-tetrahydro-2H-imidazo[2,1-b][1,3]thiazin-1-ium bromide
|
| Molecular Formula |
C21H25BrN2O2S
|
| Molecular Weight |
449.4
|
| Smiles |
CCOc1ccc(N2CC(O)(c3ccc(C)cc3)[N+]3=C2SCCC3)cc1.[Br-]
|
CCOc1ccc(N2CC(O)(c3ccc(C)cc3)[N+]3=C2SCCC3)cc1.[Br-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.