| Name |
9-(2,4-dimethylphenyl)-1-methyl-3-pentyl-1H,2H,3H,4H,6H,7H,8H,9H-pyrimido[1,2-g]purine-2,4-dione
|
| Molecular Formula |
C22H29N5O2
|
| Molecular Weight |
395.5
|
| Smiles |
CCCCCn1c(=O)c2c(nc3n2CCCN3c2ccc(C)cc2C)n(C)c1=O
|
CCCCCn1c(=O)c2c(nc3n2CCCN3c2ccc(C)cc2C)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.