| Name |
(3Z)-1-allyl-3-[2-(2-bromophenyl)-6-oxo[1,3]thiazolo[3,2-b][1,2,4]triazol-5(6H)-ylidene]-1,3-dihydro-2H-indol-2-one
|
| Molecular Formula |
C21H13BrN4O2S
|
| Molecular Weight |
465.3
|
| Smiles |
C=CCN1C(=O)C(=c2sc3nc(-c4ccccc4Br)nn3c2=O)c2ccccc21
|
C=CCN1C(=O)C(=c2sc3nc(-c4ccccc4Br)nn3c2=O)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.