| Name |
1-ethyl-4'-hydroxy-3'-[(4-methylphenyl)carbonyl]-1'-[3-(morpholin-4-yl)propyl]spiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione
|
| Molecular Formula |
C28H31N3O5
|
| Molecular Weight |
489.6
|
| Smiles |
CCN1C(=O)C2(C(=C(O)c3ccc(C)cc3)C(=O)C(=O)N2CCCN2CCOCC2)c2ccccc21
|
CCN1C(=O)C2(C(=C(O)c3ccc(C)cc3)C(=O)C(=O)N2CCCN2CCOCC2)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.