| Name |
methyl (2E)-[3-(2,3-dimethylcyclohexyl)-6-oxo-3,4-dihydro-2H-[1,3]thiazolo[3,2-a][1,3,5]triazin-7(6H)-ylidene]ethanoate
|
| Molecular Formula |
C16H23N3O3S
|
| Molecular Weight |
337.4
|
| Smiles |
COC(=O)C=c1sc2n(c1=O)CN(C1CCCC(C)C1C)CN=2
|
COC(=O)C=c1sc2n(c1=O)CN(C1CCCC(C)C1C)CN=2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.