| Name |
1,6-Bis(4-hydroxyphenyl)-1,6-hexanedione
|
| Molecular Formula |
C18H18O4
|
| Molecular Weight |
298.3
|
| Smiles |
O=C(CCCCC(=O)c1ccc(O)cc1)c1ccc(O)cc1
|
O=C(CCCCC(=O)c1ccc(O)cc1)c1ccc(O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.