| Name |
(S)-4-Ethyl-3,6,10-trioxo-3,4,6,7,8,10-hexahydro-1H-pyrano[3,4-f]indolizin-4-yl acetate
|
| Molecular Formula |
C15H15NO6
|
| Molecular Weight |
305.28
|
| Smiles |
CCC1(OC(C)=O)C(=O)OCc2c1cc1n(c2=O)CCC1=O
|
CCC1(OC(C)=O)C(=O)OCc2c1cc1n(c2=O)CCC1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.