| Name |
(11bR)-2,6-Diethynyl-4-hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide
|
| Molecular Formula |
C24H13O4P
|
| Molecular Weight |
396.3
|
| Smiles |
C#Cc1cc2ccccc2c2c1OP(=O)(O)Oc1c(C#C)cc3ccccc3c1-2
|
C#Cc1cc2ccccc2c2c1OP(=O)(O)Oc1c(C#C)cc3ccccc3c1-2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.