| Name |
2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)ethanesulfonyl fluoride
|
| Molecular Formula |
C9H11FN4O4S
|
| Molecular Weight |
290.27
|
| Smiles |
Cn1c(=O)c2c(ncn2CCS(=O)(=O)F)n(C)c1=O
|
Cn1c(=O)c2c(ncn2CCS(=O)(=O)F)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.