| Name |
6-(Aminomethyl)-1,3-dimethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione hydrochloride
|
| Molecular Formula |
C7H12ClN3O2
|
| Molecular Weight |
205.64
|
| Smiles |
Cl.Cn1c(CN)cc(=O)n(C)c1=O
|
Cl.Cn1c(CN)cc(=O)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.