| Name |
1-Methoxycarbonyl-1-trifluoromethyl-1,2,3,4-tetrahydro-9h-pyrido[3,4-b]indole
|
| Molecular Formula |
C14H13F3N2O2
|
| Molecular Weight |
298.26
|
| Smiles |
COC(=O)C1(C(F)(F)F)NCCc2c1[nH]c1ccccc21
|
COC(=O)C1(C(F)(F)F)NCCc2c1[nH]c1ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.