| Name |
2-({4-ethyl-5-[(5,6,7,8-tetrahydronaphthalen-2-yloxy)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)-N-(naphthalen-1-yl)acetamide
|
| Molecular Formula |
C27H28N4O2S
|
| Molecular Weight |
472.6
|
| Smiles |
CCn1c(COc2ccc3c(c2)CCCC3)nnc1SCC(=O)Nc1cccc2ccccc12
|
CCn1c(COc2ccc3c(c2)CCCC3)nnc1SCC(=O)Nc1cccc2ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.