| Name |
N-(3,5-dimethylphenyl)-2-(3,4-dioxo-8-phenyl-3,4,7,8-tetrahydroimidazo[2,1-c][1,2,4]triazin-2(6H)-yl)acetamide
|
| Molecular Formula |
C21H21N5O3
|
| Molecular Weight |
391.4
|
| Smiles |
Cc1cc(C)cc(NC(=O)Cn2nc3n(c(=O)c2=O)CCN3c2ccccc2)c1
|
Cc1cc(C)cc(NC(=O)Cn2nc3n(c(=O)c2=O)CCN3c2ccccc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.