| Name |
2-(4-methylbenzyl)-8-phenyl-7,8-dihydroimidazo[2,1-c][1,2,4]triazine-3,4(2H,6H)-dione
|
| Molecular Formula |
C19H18N4O2
|
| Molecular Weight |
334.4
|
| Smiles |
Cc1ccc(Cn2nc3n(c(=O)c2=O)CCN3c2ccccc2)cc1
|
Cc1ccc(Cn2nc3n(c(=O)c2=O)CCN3c2ccccc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.