| Name |
ethyl 2-[({[4-(1,1-dioxido-2H-1,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanoyl]oxy}acetyl)amino]benzoate
|
| Molecular Formula |
C24H27N3O7S
|
| Molecular Weight |
501.6
|
| Smiles |
CCOC(=O)c1ccccc1NC(=O)COC(=O)CC(C)(C)CC1=NS(=O)(=O)c2ccccc2N1
|
CCOC(=O)c1ccccc1NC(=O)COC(=O)CC(C)(C)CC1=NS(=O)(=O)c2ccccc2N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.